| MolName | [3-benzoyloxy-4-[(Z)-[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C29H21N2O6F |
| Smiles | O=C(COc(cc1)ccc1F)N/N=C\c(ccc(OC(c1ccccc1)=O)c1)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C29H21FN2O6/c30-23-12-15-24(16-13-23)36-19-27(33)32-31-18-22-11-14-25(37-28(34)20-7-3-1-4-8-20)17-26(22)38-29(35)21-9-5-2-6-10-21/h1-18H,19H2,(H,32,33) |
| InChIK | JCHFQWBTDUGRQA-UHFFFAOYSA-N |
| TotalMolweight | 512.492 |
| Molweight | 512.492 |
| MonoisotopicMass | 512.138366 |
| CLogP | 5.7383 |
| CLogS | -6.755 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 392.12 |
| Relative PSA | 0.23485 |
| PolarSurfaceArea | 103.29 |
| Druglikeness | 2.6289 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55263 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 11 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - [3-benzoyloxy-4-[(Z)-[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate | 2 - [3-benzoyloxy-4-[(Z)-[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate