| MolName | 2-[(E)-[(2Z)-2-(diaminomethylidenehydrazinylidene)ethylidene]amino]guanidine |
| MolecularFormula | C4H10N8 |
| Smiles | NC(N)=N/N=C/C=N\N=C(N)N |
| InChI | InChI=1S/C4H10N8/c5-3(6)11-9-1-2-10-12-4(7)8/h1-2H,(H4,5,6,11)(H4,7,8,12) |
| InChIK | JCJMVSDVPRRNSU-UHFFFAOYSA-N |
| TotalMolweight | 170.179 |
| Molweight | 170.179 |
| MonoisotopicMass | 170.102842 |
| CLogP | -0.74 |
| CLogS | -2.5 |
| H Acceptors | 8 |
| H Donors | 4 |
| TotalSurfaceArea | 143.04 |
| Relative PSA | 0.74888 |
| PolarSurfaceArea | 153.52 |
| Druglikeness | 1.5909 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.83333 |
| Fragments | 1 |
| Non HAtoms | 12 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Symmetricatoms | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(E)-[(2Z)-2-(diaminomethylidenehydrazinylidene)ethylidene]amino]guanidine | 2 - 2-[(E)-[(2Z)-2-(diaminomethylidenehydrazinylidene)ethylidene]amino]guanidine