| MolName | (Z)-1-(5-bromothiophen-2-yl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine |
| MolecularFormula | C16H17N3BrClS |
| Smiles | Clc1c(CN(CC2)CCN2/N=C\c(s2)ccc2Br)cccc1 |
| InChI | InChI=1S/C16H17BrClN3S/c17-16-6-5-14(22-16)11-19-21-9-7-20(8-10-21)12-13-3-1-2-4-15(13)18/h1-6,11H,7-10,12H2 |
| InChIK | JCUMWNRTXGLVBA-UHFFFAOYSA-N |
| TotalMolweight | 398.755 |
| Molweight | 398.755 |
| MonoisotopicMass | 397.001505 |
| CLogP | 4.4215 |
| CLogS | -4.253 |
| H Acceptors | 3 |
| TotalSurfaceArea | 263.67 |
| Relative PSA | 0.1478 |
| PolarSurfaceArea | 47.08 |
| Druglikeness | 4.5014 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(5-bromothiophen-2-yl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine | 2 - (Z)-1-(5-bromothiophen-2-yl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine