| MolName | 1-cyclohexyl-3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]thiourea |
| MolecularFormula | C21H27N5OS2 |
| Smiles | S=C(NC1CCCCC1)N/N=C\c1c(-c2ccccc2)nc(N2CCOCC2)s1 |
| InChI | InChI=1S/C21H27N5OS2/c28-20(23-17-9-5-2-6-10-17)25-22-15-18-19(16-7-3-1-4-8-16)24-21(29-18)26-11-13-27-14-12-26/h1,3-4,7-8,15,17H,2,5-6,9-14H2,(H2,23,25,28) |
| InChIK | JDAWGUMRUAXOJG-UHFFFAOYSA-N |
| TotalMolweight | 429.611 |
| Molweight | 429.611 |
| MonoisotopicMass | 429.1657 |
| CLogP | 4.5659 |
| CLogS | -6.112 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 337.75 |
| Relative PSA | 0.31772 |
| PolarSurfaceArea | 122.11 |
| Druglikeness | -0.36014 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 12 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-cyclohexyl-3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]thiourea | 2 - 1-cyclohexyl-3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]thiourea