| MolName | [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| MolecularFormula | C23H25N7O5 |
| Smiles | O=C(c1ccco1)Oc1ccc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C23H25N7O5/c31-20(19-2-1-11-34-19)35-18-5-3-17(4-6-18)16-24-28-21-25-22(29-7-12-32-13-8-29)27-23(26-21)30-9-14-33-15-10-30/h1-6,11,16H,7-10,12-15H2,(H,25,26,27,28) |
| InChIK | JDCKZKDMTLBHTJ-UHFFFAOYSA-N |
| TotalMolweight | 479.496 |
| Molweight | 479.496 |
| MonoisotopicMass | 479.191718 |
| CLogP | 4.2197 |
| CLogS | -4.693 |
| H Acceptors | 12 |
| H Donors | 1 |
| TotalSurfaceArea | 366.4 |
| Relative PSA | 0.32787 |
| PolarSurfaceArea | 127.44 |
| Druglikeness | 3.2426 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 11 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate | 2 - [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate