| MolName | N-[(Z)-[1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine |
| MolecularFormula | C25H21N4OClS |
| Smiles | Clc(cccc1)c1OCCCn1c(cccc2)c2c(/C=N\Nc2nc(cccc3)c3s2)c1 |
| InChI | InChI=1S/C25H21ClN4OS/c26-20-9-2-5-12-23(20)31-15-7-14-30-17-18(19-8-1-4-11-22(19)30)16-27-29-25-28-21-10-3-6-13-24(21)32-25/h1-6,8-13,16-17H,7,14-15H2,(H,28,29) |
| InChIK | JDIMBFLXYRQEIH-UHFFFAOYSA-N |
| TotalMolweight | 460.988 |
| Molweight | 460.988 |
| MonoisotopicMass | 460.112458 |
| CLogP | 8.1506 |
| CLogS | -6.265 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 348.8 |
| Relative PSA | 0.20404 |
| PolarSurfaceArea | 79.68 |
| Druglikeness | 4.0785 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine | 2 - N-[(Z)-[1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine