| MolName | 5-[(2Z)-2-[[2,4-bis(difluoromethoxy)phenyl]methylidene]hydrazinyl]-2-chlorobenzoic acid |
| MolecularFormula | C16H11N2O4ClF4 |
| Smiles | OC(c(cc(cc1)N/N=C\c(ccc(OC(F)F)c2)c2OC(F)F)c1Cl)=O |
| InChI | InChI=1S/C16H11ClF4N2O4/c17-12-4-2-9(5-11(12)14(24)25)23-22-7-8-1-3-10(26-15(18)19)6-13(8)27-16(20)21/h1-7,15-16,23H,(H,24,25) |
| InChIK | JDKIOFGCUSMFIS-UHFFFAOYSA-N |
| TotalMolweight | 406.718 |
| Molweight | 406.718 |
| MonoisotopicMass | 406.034347 |
| CLogP | 5.2708 |
| CLogS | -5.142 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 279.16 |
| Relative PSA | 0.24756 |
| PolarSurfaceArea | 80.15 |
| Druglikeness | -0.88877 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(2Z)-2-[[2,4-bis(difluoromethoxy)phenyl]methylidene]hydrazinyl]-2-chlorobenzoic acid | 2 - 5-[(2Z)-2-[[2,4-bis(difluoromethoxy)phenyl]methylidene]hydrazinyl]-2-chlorobenzoic acid