| MolName | N-[(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)cyclohexen-1-yl]methylideneamino]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| MolecularFormula | C19H17N5O3S2 |
| Smiles | O=C(C(NC(N1)=O)=CC1=O)N/N=C\C(CCCC1)=C1Sc1nc(cccc2)c2s1 |
| InChI | InChI=1S/C19H17N5O3S2/c25-16-9-13(21-18(27)23-16)17(26)24-20-10-11-5-1-3-7-14(11)28-19-22-12-6-2-4-8-15(12)29-19/h2,4,6,8-10H,1,3,5,7H2,(H,24,26)(H2,21,23,25,27) |
| InChIK | JDNICNKRKZIYGN-UHFFFAOYSA-N |
| TotalMolweight | 427.508 |
| Molweight | 427.508 |
| MonoisotopicMass | 427.07728 |
| CLogP | 2.2419 |
| CLogS | -5.727 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 308.11 |
| Relative PSA | 0.43436 |
| PolarSurfaceArea | 166.09 |
| Druglikeness | 0.85309 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 9 |
| Sp3Atoms | 5 |
| Amides | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)cyclohexen-1-yl]methylideneamino]-2,4-dioxo-1H-pyrimidine-6-carboxamide | 2 - N-[(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)cyclohexen-1-yl]methylideneamino]-2,4-dioxo-1H-pyrimidine-6-carboxamide