| MolName | (Z)-N-[(Z)-pyridin-2-ylmethylideneamino]fluoren-9-imine |
| MolecularFormula | C19H13N3 |
| Smiles | C(c1ncccc1)=N\N=C1c(cccc2)c2-c2c1cccc2 |
| InChI | InChI=1S/C19H13N3/c1-3-10-17-15(8-1)16-9-2-4-11-18(16)19(17)22-21-13-14-7-5-6-12-20-14/h1-13H |
| InChIK | JDSDAPMFXLXKHN-UHFFFAOYSA-N |
| TotalMolweight | 283.333 |
| Molweight | 283.333 |
| MonoisotopicMass | 283.110947 |
| CLogP | 5.4217 |
| CLogS | -6.137 |
| H Acceptors | 3 |
| TotalSurfaceArea | 225.77 |
| Relative PSA | 0.15055 |
| PolarSurfaceArea | 37.61 |
| Druglikeness | 1.9419 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-pyridin-2-ylmethylideneamino]fluoren-9-imine | 2 - (Z)-N-[(Z)-pyridin-2-ylmethylideneamino]fluoren-9-imine