| MolName | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[(Z)-(3-nitrophenyl)methylideneamino]thiourea |
| MolecularFormula | C12H14N4O4S2 |
| Smiles | [O-][N+](c1cccc(/C=N\NC(N[C@H](CC2)CS2(=O)=O)=S)c1)=O |
| InChI | InChI=1S/C12H14N4O4S2/c17-16(18)11-3-1-2-9(6-11)7-13-15-12(21)14-10-4-5-22(19,20)8-10/h1-3,6-7,10H,4-5,8H2,(H2,14,15,21)/t10-/m0/s1 |
| InChIK | JFBTYDXZKSCGJC-JTQLQIEISA-N |
| TotalMolweight | 342.399 |
| Molweight | 342.399 |
| MonoisotopicMass | 342.045646 |
| CLogP | 0.3256 |
| CLogS | -3.818 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 246.18 |
| Relative PSA | 0.49326 |
| PolarSurfaceArea | 156.85 |
| Druglikeness | -5.3738 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| StereoCenters | 1 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| Symmetricatoms | 1 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[(Z)-(3-nitrophenyl)methylideneamino]thiourea | 2 - 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[(Z)-(3-nitrophenyl)methylideneamino]thiourea