| MolName | N-[(Z)-[3-(2-cyano-4-nitrophenoxy)phenyl]methylideneamino]naphthalene-2-carboxamide |
| MolecularFormula | C25H16N4O4 |
| Smiles | N#Cc(cc(cc1)[N+]([O-])=O)c1Oc1cc(/C=N\NC(c2cc3ccccc3cc2)=O)ccc1 |
| InChI | InChI=1S/C25H16N4O4/c26-15-21-14-22(29(31)32)10-11-24(21)33-23-7-3-4-17(12-23)16-27-28-25(30)20-9-8-18-5-1-2-6-19(18)13-20/h1-14,16H,(H,28,30) |
| InChIK | JFDULZAYMLYQHW-UHFFFAOYSA-N |
| TotalMolweight | 436.426 |
| Molweight | 436.426 |
| MonoisotopicMass | 436.117156 |
| CLogP | 4.7056 |
| CLogS | -8.857 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 336.73 |
| Relative PSA | 0.26725 |
| PolarSurfaceArea | 120.3 |
| Druglikeness | -5.1395 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60606 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-(2-cyano-4-nitrophenoxy)phenyl]methylideneamino]naphthalene-2-carboxamide | 2 - N-[(Z)-[3-(2-cyano-4-nitrophenoxy)phenyl]methylideneamino]naphthalene-2-carboxamide