| MolName | 4-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C23H16N8O2S |
| Smiles | [O-][N+](c(cc1)ccc1-c(c(/C=N\N(C(c1ccncc1)=NN1)C1=S)c1)nn1-c1ccccc1)=O |
| InChI | InChI=1S/C23H16N8O2S/c32-31(33)20-8-6-16(7-9-20)21-18(15-29(28-21)19-4-2-1-3-5-19)14-25-30-22(26-27-23(30)34)17-10-12-24-13-11-17/h1-15H,(H,27,34) |
| InChIK | JFHQFSYQCQJWQA-UHFFFAOYSA-N |
| TotalMolweight | 468.5 |
| Molweight | 468.5 |
| MonoisotopicMass | 468.111692 |
| CLogP | 2.2915 |
| CLogS | -5.629 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 351.63 |
| Relative PSA | 0.35623 |
| PolarSurfaceArea | 148.61 |
| Druglikeness | -1.0552 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.47059 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione