| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(Z)-[5-(5-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C23H17N10O5Cl |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2ccc(-c(cc(cc3)Cl)c3[N+]([O-])=O)o2)=O)c1CNc1ccccc1 |
| InChI | InChI=1S/C23H17ClN10O5/c24-13-6-8-17(34(36)37)16(10-13)19-9-7-15(38-19)11-27-29-23(35)20-18(12-26-14-4-2-1-3-5-14)33(32-28-20)22-21(25)30-39-31-22/h1-11,26H,12H2,(H2,25,30)(H,29,35) |
| InChIK | JFOYILFIHLHFKL-UHFFFAOYSA-N |
| TotalMolweight | 548.906 |
| Molweight | 548.906 |
| MonoisotopicMass | 548.107192 |
| CLogP | 3.4378 |
| CLogS | -5.491 |
| H Acceptors | 15 |
| H Donors | 3 |
| TotalSurfaceArea | 402.72 |
| Relative PSA | 0.42742 |
| PolarSurfaceArea | 208.1 |
| Druglikeness | -0.84236 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48718 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(Z)-[5-(5-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(Z)-[5-(5-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]triazole-4-carboxamide