| MolName | 2-(4-benzylpiperazin-1-yl)-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide |
| MolecularFormula | C20H23N5O3 |
| Smiles | [O-][N+](c1cc(/C=N\NC(CN2CCN(Cc3ccccc3)CC2)=O)ccc1)=O |
| InChI | InChI=1S/C20H23N5O3/c26-20(22-21-14-18-7-4-8-19(13-18)25(27)28)16-24-11-9-23(10-12-24)15-17-5-2-1-3-6-17/h1-8,13-14H,9-12,15-16H2,(H,22,26) |
| InChIK | JFRJGYFIKJHRGU-UHFFFAOYSA-N |
| TotalMolweight | 381.435 |
| Molweight | 381.435 |
| MonoisotopicMass | 381.18009 |
| CLogP | -0.2268 |
| CLogS | -3.026 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 300.32 |
| Relative PSA | 0.24484 |
| PolarSurfaceArea | 93.76 |
| Druglikeness | 4.1443 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Amines | 2 |
| AlkylAmines | 2 |
| BasicNitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-benzylpiperazin-1-yl)-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide | 2 - 2-(4-benzylpiperazin-1-yl)-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide