| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyl-N-[(Z)-pyridin-3-ylmethylideneamino]triazole-4-carboxamide |
| MolecularFormula | C17H13N9O2 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cnccc2)=O)c1-c1ccccc1 |
| InChI | InChI=1S/C17H13N9O2/c18-15-16(24-28-23-15)26-14(12-6-2-1-3-7-12)13(21-25-26)17(27)22-20-10-11-5-4-8-19-9-11/h1-10H,(H2,18,23)(H,22,27) |
| InChIK | JGEQWKCSFMPPTC-UHFFFAOYSA-N |
| TotalMolweight | 375.351 |
| Molweight | 375.351 |
| MonoisotopicMass | 375.119221 |
| CLogP | 2.4447 |
| CLogS | -2.411 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 287.72 |
| Relative PSA | 0.44178 |
| PolarSurfaceArea | 150 |
| Druglikeness | 1.9983 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 6 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyl-N-[(Z)-pyridin-3-ylmethylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyl-N-[(Z)-pyridin-3-ylmethylideneamino]triazole-4-carboxamide