| MolName | 5-N-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-(4-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| MolecularFormula | C21H12N8O4ClF |
| Smiles | [O-][N+](c(cc(cc1)-c2ccc(/C=N\Nc3nc4nonc4nc3Nc(cc3)ccc3F)o2)c1Cl)=O |
| InChI | InChI=1S/C21H12ClFN8O4/c22-15-7-1-11(9-16(15)31(32)33)17-8-6-14(34-17)10-24-28-19-18(25-13-4-2-12(23)3-5-13)26-20-21(27-19)30-35-29-20/h1-10H,(H,25,26,29)(H,27,28,30) |
| InChIK | JGNIZCBDGUWOEP-UHFFFAOYSA-N |
| TotalMolweight | 494.829 |
| Molweight | 494.829 |
| MonoisotopicMass | 494.065407 |
| CLogP | 6.3129 |
| CLogS | -8.486 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 354.68 |
| Relative PSA | 0.38612 |
| PolarSurfaceArea | 160.08 |
| Druglikeness | -0.9613 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-N-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-(4-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine | 2 - 5-N-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-(4-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine