| MolName | 2-phenyl-N-[(Z)-2-phenylethylideneamino]acetamide |
| MolecularFormula | C16H16N2O |
| Smiles | O=C(Cc1ccccc1)N/N=C\Cc1ccccc1 |
| InChI | InChI=1S/C16H16N2O/c19-16(13-15-9-5-2-6-10-15)18-17-12-11-14-7-3-1-4-8-14/h1-10,12H,11,13H2,(H,18,19) |
| InChIK | JGSJBENEJRWPTO-UHFFFAOYSA-N |
| TotalMolweight | 252.316 |
| Molweight | 252.316 |
| MonoisotopicMass | 252.126263 |
| CLogP | 2.8869 |
| CLogS | -3.573 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 214.51 |
| Relative PSA | 0.16787 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 4.3705 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73684 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-phenyl-N-[(Z)-2-phenylethylideneamino]acetamide | 2 - 2-phenyl-N-[(Z)-2-phenylethylideneamino]acetamide