| MolName | 2-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]benzoic acid |
| MolecularFormula | C17H13N3O3S2 |
| Smiles | OC(c1c(/C=N/NC(CSc2nc(cccc3)c3s2)=O)cccc1)=O |
| InChI | InChI=1S/C17H13N3O3S2/c21-15(10-24-17-19-13-7-3-4-8-14(13)25-17)20-18-9-11-5-1-2-6-12(11)16(22)23/h1-9H,10H2,(H,20,21)(H,22,23) |
| InChIK | JHJSSQFJTFBLCX-UHFFFAOYSA-N |
| TotalMolweight | 371.44 |
| Molweight | 371.44 |
| MonoisotopicMass | 371.039832 |
| CLogP | 3.4014 |
| CLogS | -5.112 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 271.64 |
| Relative PSA | 0.40852 |
| PolarSurfaceArea | 145.19 |
| Druglikeness | 4.5747 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]benzoic acid | 2 - 2-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]benzoic acid