| MolName | 4,6-di(piperidin-1-yl)-N-[(Z)-pyridin-2-ylmethylideneamino]-1,3,5-triazin-2-amine |
| MolecularFormula | C19H26N8 |
| Smiles | C(CC1)CCN1c1nc(N/N=C\c2ncccc2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C19H26N8/c1-5-11-26(12-6-1)18-22-17(25-21-15-16-9-3-4-10-20-16)23-19(24-18)27-13-7-2-8-14-27/h3-4,9-10,15H,1-2,5-8,11-14H2,(H,22,23,24,25) |
| InChIK | JHOBSHRANAZBGA-UHFFFAOYSA-N |
| TotalMolweight | 366.471 |
| Molweight | 366.471 |
| MonoisotopicMass | 366.228042 |
| CLogP | 4.9816 |
| CLogS | -4.548 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 295.48 |
| Relative PSA | 0.25027 |
| PolarSurfaceArea | 82.43 |
| Druglikeness | 2.872 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51852 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4,6-di(piperidin-1-yl)-N-[(Z)-pyridin-2-ylmethylideneamino]-1,3,5-triazin-2-amine | 2 - 4,6-di(piperidin-1-yl)-N-[(Z)-pyridin-2-ylmethylideneamino]-1,3,5-triazin-2-amine