| MolName | 4,6-dimorpholin-4-yl-N-[(Z)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1,3,5-triazin-2-amine |
| MolecularFormula | C25H28N8O5 |
| Smiles | [O-][N+](c1ccc(COc2c(/C=N\Nc3nc(N4CCOCC4)nc(N4CCOCC4)n3)cccc2)cc1)=O |
| InChI | InChI=1S/C25H28N8O5/c34-33(35)21-7-5-19(6-8-21)18-38-22-4-2-1-3-20(22)17-26-30-23-27-24(31-9-13-36-14-10-31)29-25(28-23)32-11-15-37-16-12-32/h1-8,17H,9-16,18H2,(H,27,28,29,30) |
| InChIK | JHRUQQAMRAMBCW-UHFFFAOYSA-N |
| TotalMolweight | 520.548 |
| Molweight | 520.548 |
| MonoisotopicMass | 520.218267 |
| CLogP | 3.5158 |
| CLogS | -5.342 |
| H Acceptors | 13 |
| H Donors | 1 |
| TotalSurfaceArea | 396.39 |
| Relative PSA | 0.31131 |
| PolarSurfaceArea | 143.05 |
| Druglikeness | -1.8712 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.52632 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 13 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4,6-dimorpholin-4-yl-N-[(Z)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1,3,5-triazin-2-amine | 2 - 4,6-dimorpholin-4-yl-N-[(Z)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1,3,5-triazin-2-amine