| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide |
| MolecularFormula | C18H14N6O2Cl2S |
| Smiles | O=C(Cc1nnc(NC(Nc2ccccc2)=O)s1)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C18H14Cl2N6O2S/c19-12-7-6-11(14(20)8-12)10-21-24-15(27)9-16-25-26-18(29-16)23-17(28)22-13-4-2-1-3-5-13/h1-8,10H,9H2,(H,24,27)(H2,22,23,26,28) |
| InChIK | JHSWSLCMMDWVBW-UHFFFAOYSA-N |
| TotalMolweight | 449.321 |
| Molweight | 449.321 |
| MonoisotopicMass | 448.027598 |
| CLogP | 4.3961 |
| CLogS | -6.393 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 325.48 |
| Relative PSA | 0.35108 |
| PolarSurfaceArea | 136.61 |
| Druglikeness | 6.4891 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide