| MolName | N-[(Z)-2,1,3-benzoxadiazol-5-ylmethylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| MolecularFormula | C18H12N4O3 |
| Smiles | Oc1cc2ccccc2cc1C(N/N=C\c1cc2nonc2cc1)=O |
| InChI | InChI=1S/C18H12N4O3/c23-17-9-13-4-2-1-3-12(13)8-14(17)18(24)20-19-10-11-5-6-15-16(7-11)22-25-21-15/h1-10,23H,(H,20,24) |
| InChIK | JHTBYCSKROWOOP-UHFFFAOYSA-N |
| TotalMolweight | 332.318 |
| Molweight | 332.318 |
| MonoisotopicMass | 332.090941 |
| CLogP | 4.001 |
| CLogS | -4.67 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 249.75 |
| Relative PSA | 0.34098 |
| PolarSurfaceArea | 100.61 |
| Druglikeness | 5.7031 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-2,1,3-benzoxadiazol-5-ylmethylideneamino]-3-hydroxynaphthalene-2-carboxamide | 2 - N-[(Z)-2,1,3-benzoxadiazol-5-ylmethylideneamino]-3-hydroxynaphthalene-2-carboxamide