| MolName | N-[(Z)-[3,5-dichloro-2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2,6-dipyrrolidin-1-ylpyrimidin-4-amine |
| MolecularFormula | C26H27N6OCl3 |
| Smiles | Clc(cc1/C=N\Nc2nc(N3CCCC3)nc(N3CCCC3)c2)cc(Cl)c1OCc(cccc1)c1Cl |
| InChI | InChI=1S/C26H27Cl3N6O/c27-20-13-19(25(22(29)14-20)36-17-18-7-1-2-8-21(18)28)16-30-33-23-15-24(34-9-3-4-10-34)32-26(31-23)35-11-5-6-12-35/h1-2,7-8,13-16H,3-6,9-12,17H2,(H,31,32,33) |
| InChIK | JHTQUVBVUXWYRT-UHFFFAOYSA-N |
| TotalMolweight | 545.9 |
| Molweight | 545.9 |
| MonoisotopicMass | 544.13119 |
| CLogP | 8.4981 |
| CLogS | -8.459 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 400.22 |
| Relative PSA | 0.15494 |
| PolarSurfaceArea | 65.88 |
| Druglikeness | 3.6858 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.47222 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 10 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3,5-dichloro-2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2,6-dipyrrolidin-1-ylpyrimidin-4-amine | 2 - N-[(Z)-[3,5-dichloro-2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2,6-dipyrrolidin-1-ylpyrimidin-4-amine