| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| MolecularFormula | C22H16N3O2Cl |
| Smiles | O=C(CN(c1c2cccc1)c(cccc1)c1C2=O)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C22H16ClN3O2/c23-18-10-4-1-7-15(18)13-24-25-21(27)14-26-19-11-5-2-8-16(19)22(28)17-9-3-6-12-20(17)26/h1-13H,14H2,(H,25,27) |
| InChIK | JIXXBYODTAJZGM-UHFFFAOYSA-N |
| TotalMolweight | 389.841 |
| Molweight | 389.841 |
| MonoisotopicMass | 389.093104 |
| CLogP | 4.9139 |
| CLogS | -7.289 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 290.48 |
| Relative PSA | 0.18108 |
| PolarSurfaceArea | 61.77 |
| Druglikeness | 6.2787 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide