| MolName | N-[2-[[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]benzamide |
| MolecularFormula | C16H16N4O4 |
| Smiles | O=C(CNC(c1ccccc1)=O)NCC(N/N=C\c1ccco1)=O |
| InChI | InChI=1S/C16H16N4O4/c21-14(10-18-16(23)12-5-2-1-3-6-12)17-11-15(22)20-19-9-13-7-4-8-24-13/h1-9H,10-11H2,(H,17,21)(H,18,23)(H,20,22) |
| InChIK | JIZBZUWILSARDJ-UHFFFAOYSA-N |
| TotalMolweight | 328.327 |
| Molweight | 328.327 |
| MonoisotopicMass | 328.117156 |
| CLogP | 0.5577 |
| CLogS | -2.937 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 262.62 |
| Relative PSA | 0.37743 |
| PolarSurfaceArea | 112.8 |
| Druglikeness | 5.3621 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]benzamide | 2 - N-[2-[[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]benzamide