| MolName | 2,4-dichloro-N-[(Z)-(3,5-dibromo-4-phenylmethoxyphenyl)methylideneamino]benzamide |
| MolecularFormula | C21H14N2O2Br2Cl2 |
| Smiles | O=C(c(ccc(Cl)c1)c1Cl)N/N=C\c(cc1Br)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C21H14Br2Cl2N2O2/c22-17-8-14(9-18(23)20(17)29-12-13-4-2-1-3-5-13)11-26-27-21(28)16-7-6-15(24)10-19(16)25/h1-11H,12H2,(H,27,28) |
| InChIK | JJDJJUUCQGLPLH-UHFFFAOYSA-N |
| TotalMolweight | 557.068 |
| Molweight | 557.068 |
| MonoisotopicMass | 553.879904 |
| CLogP | 7.2121 |
| CLogS | -8.202 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 338.61 |
| Relative PSA | 0.13588 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 2.2614 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - 2,4-dichloro-N-[(Z)-(3,5-dibromo-4-phenylmethoxyphenyl)methylideneamino]benzamide | 2 - 2,4-dichloro-N-[(Z)-(3,5-dibromo-4-phenylmethoxyphenyl)methylideneamino]benzamide