| MolName | 4-amino-N'-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| MolecularFormula | C14H10N6O2Cl2 |
| Smiles | N/C(/c1nonc1N)=N/N=C\c1ccc(-c(ccc(Cl)c2)c2Cl)o1 |
| InChI | InChI=1S/C14H10Cl2N6O2/c15-7-1-3-9(10(16)5-7)11-4-2-8(23-11)6-19-20-13(17)12-14(18)22-24-21-12/h1-6H,(H2,17,20)(H2,18,22) |
| InChIK | JJKXDJLNNVXIAK-UHFFFAOYSA-N |
| TotalMolweight | 365.179 |
| Molweight | 365.179 |
| MonoisotopicMass | 364.024228 |
| CLogP | 4.3299 |
| CLogS | -5.697 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 265.29 |
| Relative PSA | 0.39097 |
| PolarSurfaceArea | 128.82 |
| Druglikeness | 4.7556 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N'-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide | 2 - 4-amino-N'-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide