| MolName | 2-[2-[(Z)-[[2-(4-chloro-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| MolecularFormula | C17H13N3O7Cl |
| Smiles | [O-]C(COc1c(/C=N\NC(COc(ccc(Cl)c2)c2[N+]([O-])=O)=O)cccc1)=O |
| InChI | InChI=1S/C17H14ClN3O7/c18-12-5-6-15(13(7-12)21(25)26)27-9-16(22)20-19-8-11-3-1-2-4-14(11)28-10-17(23)24/h1-8H,9-10H2,(H,20,22)(H,23,24)/p-1 |
| InChIK | JJLJCRCAUZPAJH-UHFFFAOYSA-M |
| TotalMolweight | 406.757 |
| Molweight | 406.757 |
| MonoisotopicMass | 406.044204 |
| CLogP | -0.5551 |
| CLogS | -4.49 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 298.88 |
| Relative PSA | 0.38059 |
| PolarSurfaceArea | 145.87 |
| Druglikeness | -0.79805 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2-(4-chloro-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate | 2 - 2-[2-[(Z)-[[2-(4-chloro-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate