| MolName | 2-[2-[(E)-[[2-(4-chloro-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C17H14N3O7Cl |
| Smiles | [O-][N+](c(cc(cc1)Cl)c1OCC(N/N=C/c(cccc1)c1OCC(O)=O)=O)=O |
| InChI | InChI=1S/C17H14ClN3O7/c18-12-5-6-15(13(7-12)21(25)26)27-9-16(22)20-19-8-11-3-1-2-4-14(11)28-10-17(23)24/h1-8H,9-10H2,(H,20,22)(H,23,24) |
| InChIK | JJLJCRCAUZPAJH-UHFFFAOYSA-N |
| TotalMolweight | 407.765 |
| Molweight | 407.765 |
| MonoisotopicMass | 407.052029 |
| CLogP | 1.5209 |
| CLogS | -4.49 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 297.7 |
| Relative PSA | 0.37813 |
| PolarSurfaceArea | 143.04 |
| Druglikeness | -0.80869 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(E)-[[2-(4-chloro-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[2-[(E)-[[2-(4-chloro-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid