| MolName | 2-thiomorpholin-4-ium-4-yl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| MolecularFormula | C14H17N3OF3S |
| Smiles | O=C(C[NH+]1CCSCC1)N/N=C\c1c(C(F)(F)F)cccc1 |
| InChI | InChI=1S/C14H16F3N3OS/c15-14(16,17)12-4-2-1-3-11(12)9-18-19-13(21)10-20-5-7-22-8-6-20/h1-4,9H,5-8,10H2,(H,19,21)/p+1 |
| InChIK | JJTXKSYXPRVMOT-UHFFFAOYSA-O |
| TotalMolweight | 332.369 |
| Molweight | 332.369 |
| MonoisotopicMass | 332.104441 |
| CLogP | 0.1658 |
| CLogS | -3.205 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 253.82 |
| Relative PSA | 0.28008 |
| PolarSurfaceArea | 71.2 |
| Druglikeness | -2.9301 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-thiomorpholin-4-ium-4-yl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide | 2 - 2-thiomorpholin-4-ium-4-yl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide