| MolName | N,N'-bis[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]oxamide |
| MolecularFormula | C24H14N6O8Cl2 |
| Smiles | [O-][N+](c(cc1)cc(Cl)c1-c1ccc(/C=N\NC(C(N/N=C\c2ccc(-c(ccc([N+]([O-])=O)c3)c3Cl)o2)=O)=O)o1)=O |
| InChI | InChI=1S/C24H14Cl2N6O8/c25-19-9-13(31(35)36)1-5-17(19)21-7-3-15(39-21)11-27-29-23(33)24(34)30-28-12-16-4-8-22(40-16)18-6-2-14(32(37)38)10-20(18)26/h1-12H,(H,29,33)(H,30,34) |
| InChIK | JKHDUGSBQTUVPF-UHFFFAOYSA-N |
| TotalMolweight | 585.315 |
| Molweight | 585.315 |
| MonoisotopicMass | 584.025018 |
| CLogP | 3.785 |
| CLogS | -9.43 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 418.04 |
| Relative PSA | 0.38532 |
| PolarSurfaceArea | 200.84 |
| Druglikeness | 0.21539 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 20 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]oxamide | 2 - N,N'-bis[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]oxamide