| MolName | [4-bromo-2-[(Z)-(cyclohexylcarbamothioylhydrazinylidene)methyl]phenyl] benzoate |
| MolecularFormula | C21H22N3O2BrS |
| Smiles | O=C(c1ccccc1)Oc(cc1)c(/C=N\NC(NC2CCCCC2)=S)cc1Br |
| InChI | InChI=1S/C21H22BrN3O2S/c22-17-11-12-19(27-20(26)15-7-3-1-4-8-15)16(13-17)14-23-25-21(28)24-18-9-5-2-6-10-18/h1,3-4,7-8,11-14,18H,2,5-6,9-10H2,(H2,24,25,28) |
| InChIK | JKLLOOOUPNHAAR-UHFFFAOYSA-N |
| TotalMolweight | 460.395 |
| Molweight | 460.395 |
| MonoisotopicMass | 459.061608 |
| CLogP | 5.5949 |
| CLogS | -6.692 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 327.59 |
| Relative PSA | 0.26091 |
| PolarSurfaceArea | 94.81 |
| Druglikeness | -4.4011 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-(cyclohexylcarbamothioylhydrazinylidene)methyl]phenyl] benzoate | 2 - [4-bromo-2-[(Z)-(cyclohexylcarbamothioylhydrazinylidene)methyl]phenyl] benzoate