| MolName | (Z)-1-[2-[2-(4-nitrophenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C17H15N5O4 |
| Smiles | [O-][N+](c(cc1)ccc1OCCOc1c(/C=N\n2cnnc2)cccc1)=O |
| InChI | InChI=1S/C17H15N5O4/c23-22(24)15-5-7-16(8-6-15)25-9-10-26-17-4-2-1-3-14(17)11-20-21-12-18-19-13-21/h1-8,11-13H,9-10H2 |
| InChIK | JLBNJZXUAQYQNE-UHFFFAOYSA-N |
| TotalMolweight | 353.337 |
| Molweight | 353.337 |
| MonoisotopicMass | 353.112405 |
| CLogP | 1.6617 |
| CLogS | -6.038 |
| H Acceptors | 9 |
| TotalSurfaceArea | 275.45 |
| Relative PSA | 0.32942 |
| PolarSurfaceArea | 107.35 |
| Druglikeness | -9.0391 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[2-[2-(4-nitrophenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[2-[2-(4-nitrophenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine