| MolName | N-[(Z)-[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-cyclopropylquinoline-4-carboxamide |
| MolecularFormula | C27H22N3O2Br |
| Smiles | O=C(c1cc(C2CC2)nc2ccccc12)N/N=C\c(cccc1)c1OCc(cc1)ccc1Br |
| InChI | InChI=1S/C27H22BrN3O2/c28-21-13-9-18(10-14-21)17-33-26-8-4-1-5-20(26)16-29-31-27(32)23-15-25(19-11-12-19)30-24-7-3-2-6-22(23)24/h1-10,13-16,19H,11-12,17H2,(H,31,32) |
| InChIK | JLCQWRHSSLEMCN-UHFFFAOYSA-N |
| TotalMolweight | 500.395 |
| Molweight | 500.395 |
| MonoisotopicMass | 499.089538 |
| CLogP | 6.7557 |
| CLogS | -7.583 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 349.02 |
| Relative PSA | 0.16326 |
| PolarSurfaceArea | 63.58 |
| Druglikeness | 2.9454 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 5 |
| Symmetricatoms | 3 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-cyclopropylquinoline-4-carboxamide | 2 - N-[(Z)-[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-cyclopropylquinoline-4-carboxamide