| MolName | (Z)-[1-(2-chlorophenyl)pyrrol-2-yl]methylidenehydrazine |
| MolecularFormula | C11H10N3Cl |
| Smiles | N/N=C\c1cccn1-c(cccc1)c1Cl |
| InChI | InChI=1S/C11H10ClN3/c12-10-5-1-2-6-11(10)15-7-3-4-9(15)8-14-13/h1-8H,13H2 |
| InChIK | JLJLGDIMBZCMPJ-UHFFFAOYSA-N |
| TotalMolweight | 219.674 |
| Molweight | 219.674 |
| MonoisotopicMass | 219.056324 |
| CLogP | 2.4117 |
| CLogS | -5.466 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 170.92 |
| Relative PSA | 0.19688 |
| PolarSurfaceArea | 43.31 |
| Druglikeness | 0.1675 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 15 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-[1-(2-chlorophenyl)pyrrol-2-yl]methylidenehydrazine | 2 - (Z)-[1-(2-chlorophenyl)pyrrol-2-yl]methylidenehydrazine