| MolName | N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide |
| MolecularFormula | C20H20N3O2F3 |
| Smiles | O=C(Cc1cccc(C(F)(F)F)c1)N/N=C\c(cc1)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H20F3N3O2/c21-20(22,23)17-3-1-2-16(12-17)13-19(27)25-24-14-15-4-6-18(7-5-15)26-8-10-28-11-9-26/h1-7,12,14H,8-11,13H2,(H,25,27) |
| InChIK | JLOODIOJQPEEDT-UHFFFAOYSA-N |
| TotalMolweight | 391.392 |
| Molweight | 391.392 |
| MonoisotopicMass | 391.150761 |
| CLogP | 3.717 |
| CLogS | -4.567 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 292.05 |
| Relative PSA | 0.1697 |
| PolarSurfaceArea | 53.93 |
| Druglikeness | -2.1036 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide | 2 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide