| MolName | [2-[(Z)-(diaminomethylidenehydrazinylidene)methyl]phenyl] benzenesulfonate |
| MolecularFormula | C14H14N4O3S |
| Smiles | NC(N)=N/N=C\c(cccc1)c1OS(c1ccccc1)(=O)=O |
| InChI | InChI=1S/C14H14N4O3S/c15-14(16)18-17-10-11-6-4-5-9-13(11)21-22(19,20)12-7-2-1-3-8-12/h1-10H,(H4,15,16,18) |
| InChIK | JMCMXQXKKZNDGC-UHFFFAOYSA-N |
| TotalMolweight | 318.356 |
| Molweight | 318.356 |
| MonoisotopicMass | 318.078661 |
| CLogP | 2.7522 |
| CLogS | -3.764 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 236.37 |
| Relative PSA | 0.38981 |
| PolarSurfaceArea | 128.51 |
| Druglikeness | -3.899 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-(diaminomethylidenehydrazinylidene)methyl]phenyl] benzenesulfonate | 2 - [2-[(Z)-(diaminomethylidenehydrazinylidene)methyl]phenyl] benzenesulfonate