| MolName | 3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| MolecularFormula | C17H13N3OCl2S |
| Smiles | O=C(c1c(N=C2)sc3c1CCCC3)N2/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C17H13Cl2N3OS/c18-11-6-5-10(13(19)7-11)8-21-22-9-20-16-15(17(22)23)12-3-1-2-4-14(12)24-16/h5-9H,1-4H2 |
| InChIK | JMDZKJKGTVULNC-UHFFFAOYSA-N |
| TotalMolweight | 378.282 |
| Molweight | 378.282 |
| MonoisotopicMass | 377.015636 |
| CLogP | 4.897 |
| CLogS | -6.523 |
| H Acceptors | 4 |
| TotalSurfaceArea | 265.41 |
| Relative PSA | 0.22595 |
| PolarSurfaceArea | 73.27 |
| Druglikeness | 1.352 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one