| MolName | 4-[(Z)-[3-(2-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid |
| MolecularFormula | C16H11N4O2ClS |
| Smiles | OC(c1ccc(/C=N\N(C(c(cccc2)c2Cl)=NN2)C2=S)cc1)=O |
| InChI | InChI=1S/C16H11ClN4O2S/c17-13-4-2-1-3-12(13)14-19-20-16(24)21(14)18-9-10-5-7-11(8-6-10)15(22)23/h1-9H,(H,20,24)(H,22,23) |
| InChIK | JMKPMTKZAXZVGP-UHFFFAOYSA-N |
| TotalMolweight | 358.808 |
| Molweight | 358.808 |
| MonoisotopicMass | 358.029123 |
| CLogP | 3.3861 |
| CLogS | -5.2 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 261.24 |
| Relative PSA | 0.35282 |
| PolarSurfaceArea | 109.38 |
| Druglikeness | 3.4424 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[3-(2-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid | 2 - 4-[(Z)-[3-(2-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid