| MolName | 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]benzamide |
| MolecularFormula | C24H18N3O3ClS |
| Smiles | O=C(c1cccc(S(Nc(cc2)ccc2Cl)(=O)=O)c1)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C24H18ClN3O3S/c25-20-11-13-21(14-12-20)28-32(30,31)22-9-4-7-18(15-22)24(29)27-26-16-19-8-3-6-17-5-1-2-10-23(17)19/h1-16,28H,(H,27,29) |
| InChIK | JMLFOBLIKGHYIP-UHFFFAOYSA-N |
| TotalMolweight | 463.944 |
| Molweight | 463.944 |
| MonoisotopicMass | 463.075739 |
| CLogP | 5.3011 |
| CLogS | -7.396 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 336.81 |
| Relative PSA | 0.22579 |
| PolarSurfaceArea | 96.01 |
| Druglikeness | 1.2989 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]benzamide | 2 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]benzamide