| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-bromophenyl)methylideneamino]-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)triazole-4-carboxamide |
| MolecularFormula | C16H14N9O2BrS2 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)ccc2Br)=O)c1CSC1=NCCS1 |
| InChI | InChI=1S/C16H14BrN9O2S2/c17-10-3-1-9(2-4-10)7-20-22-15(27)12-11(8-30-16-19-5-6-29-16)26(25-21-12)14-13(18)23-28-24-14/h1-4,7H,5-6,8H2,(H2,18,23)(H,22,27) |
| InChIK | JMNMGSZGHDKKOM-UHFFFAOYSA-N |
| TotalMolweight | 508.384 |
| Molweight | 508.384 |
| MonoisotopicMass | 506.989522 |
| CLogP | 3.8104 |
| CLogS | -4.257 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 333.56 |
| Relative PSA | 0.48756 |
| PolarSurfaceArea | 200.07 |
| Druglikeness | 0.86548 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-bromophenyl)methylideneamino]-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-bromophenyl)methylideneamino]-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)triazole-4-carboxamide