| MolName | 2-hydroxy-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-phenylacetamide |
| MolecularFormula | C13H11N3O5 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(C(c2ccccc2)O)=O)o1)=O |
| InChI | InChI=1S/C13H11N3O5/c17-12(9-4-2-1-3-5-9)13(18)15-14-8-10-6-7-11(21-10)16(19)20/h1-8,12,17H,(H,15,18)/t12-/m1/s1 |
| InChIK | JMRMNRJOMDDHSK-GFCCVEGCSA-N |
| TotalMolweight | 289.246 |
| Molweight | 289.246 |
| MonoisotopicMass | 289.069872 |
| CLogP | 0.7481 |
| CLogS | -3.805 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 219.2 |
| Relative PSA | 0.42719 |
| PolarSurfaceArea | 120.65 |
| Druglikeness | 3.7222 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 1 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon | racemate |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-phenylacetamide | 2 - 2-hydroxy-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-phenylacetamide