| MolName | N-(2-chlorophenyl)-N'-[(Z)-[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| MolecularFormula | C23H17N4O4Cl3 |
| Smiles | O=C(COc1ccc(/C=N\NC(C(Nc(cccc2)c2Cl)=O)=O)cc1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H17Cl3N4O4/c24-15-9-16(25)11-17(10-15)28-21(31)13-34-18-7-5-14(6-8-18)12-27-30-23(33)22(32)29-20-4-2-1-3-19(20)26/h1-12H,13H2,(H,28,31)(H,29,32)(H,30,33) |
| InChIK | JNEYCCJSSOBATQ-UHFFFAOYSA-N |
| TotalMolweight | 519.771 |
| Molweight | 519.771 |
| MonoisotopicMass | 518.031537 |
| CLogP | 4.6843 |
| CLogS | -7.025 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 375.19 |
| Relative PSA | 0.25323 |
| PolarSurfaceArea | 108.89 |
| Druglikeness | 3.5754 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 5 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-(2-chlorophenyl)-N'-[(Z)-[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide | 2 - N-(2-chlorophenyl)-N'-[(Z)-[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide