| MolName | (Z)-3-[(Z)-(4-bromophenyl)methylideneamino]-N-(2-morpholin-4-ium-4-ylethyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine |
| MolecularFormula | C22H23N5O3BrS |
| Smiles | [O-][N+](c1cccc(C(N2/N=C\c(cc3)ccc3Br)=CS/C2=N\CC[NH+]2CCOCC2)c1)=O |
| InChI | InChI=1S/C22H22BrN5O3S/c23-19-6-4-17(5-7-19)15-25-27-21(18-2-1-3-20(14-18)28(29)30)16-32-22(27)24-8-9-26-10-12-31-13-11-26/h1-7,14-16H,8-13H2/p+1 |
| InChIK | JNPDIQZJUBQCIC-UHFFFAOYSA-O |
| TotalMolweight | 517.427 |
| Molweight | 517.427 |
| MonoisotopicMass | 516.070496 |
| CLogP | 2.5036 |
| CLogS | -5.256 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 365.45 |
| Relative PSA | 0.2793 |
| PolarSurfaceArea | 112.75 |
| Druglikeness | -4.41 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-3-[(Z)-(4-bromophenyl)methylideneamino]-N-(2-morpholin-4-ium-4-ylethyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine | 2 - (Z)-3-[(Z)-(4-bromophenyl)methylideneamino]-N-(2-morpholin-4-ium-4-ylethyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine