| MolName | 1-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)thiourea |
| MolecularFormula | C19H19N4O5ClS2 |
| Smiles | O=S(c(cc1)cc(NC(N/N=C\c(cc2)cc3c2OCO3)=S)c1Cl)(N1CCOCC1)=O |
| InChI | InChI=1S/C19H19ClN4O5S2/c20-15-3-2-14(31(25,26)24-5-7-27-8-6-24)10-16(15)22-19(30)23-21-11-13-1-4-17-18(9-13)29-12-28-17/h1-4,9-11H,5-8,12H2,(H2,22,23,30) |
| InChIK | JNRZQHJSBWIJOR-UHFFFAOYSA-N |
| TotalMolweight | 482.968 |
| Molweight | 482.968 |
| MonoisotopicMass | 482.048538 |
| CLogP | 3.3524 |
| CLogS | -4.974 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 339.51 |
| Relative PSA | 0.36688 |
| PolarSurfaceArea | 141.96 |
| Druglikeness | 3.7749 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)thiourea | 2 - 1-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)thiourea