| MolName | N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| MolecularFormula | C21H21N3OS |
| Smiles | C(c1ccccc1)Oc1cccc(/C=N\Nc2nc(CCCC3)c3s2)c1 |
| InChI | InChI=1S/C21H21N3OS/c1-2-7-16(8-3-1)15-25-18-10-6-9-17(13-18)14-22-24-21-23-19-11-4-5-12-20(19)26-21/h1-3,6-10,13-14H,4-5,11-12,15H2,(H,23,24) |
| InChIK | JNXSYROVQASOBW-UHFFFAOYSA-N |
| TotalMolweight | 363.484 |
| Molweight | 363.484 |
| MonoisotopicMass | 363.140532 |
| CLogP | 7.1073 |
| CLogS | -5.449 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 289 |
| Relative PSA | 0.22249 |
| PolarSurfaceArea | 74.75 |
| Druglikeness | -1.5066 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine | 2 - N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine