| MolName | 2-(2,4-dichlorophenyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]quinazolin-4-amine |
| MolecularFormula | C21H12N4Cl4 |
| Smiles | Clc1cc(Cl)c(/C=N\Nc2nc(-c(ccc(Cl)c3)c3Cl)nc3ccccc23)cc1 |
| InChI | InChI=1S/C21H12Cl4N4/c22-13-6-5-12(17(24)9-13)11-26-29-21-16-3-1-2-4-19(16)27-20(28-21)15-8-7-14(23)10-18(15)25/h1-11H,(H,27,28,29) |
| InChIK | JOLDYBYPSUVLCU-UHFFFAOYSA-N |
| TotalMolweight | 462.166 |
| Molweight | 462.166 |
| MonoisotopicMass | 459.981604 |
| CLogP | 9.013 |
| CLogS | -9.26 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 322.8 |
| Relative PSA | 0.13913 |
| PolarSurfaceArea | 50.17 |
| Druglikeness | 2.3845 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2,4-dichlorophenyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]quinazolin-4-amine | 2 - 2-(2,4-dichlorophenyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]quinazolin-4-amine