| MolName | N-[2-[(2Z)-2-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| MolecularFormula | C24H19N3O5Cl2 |
| Smiles | O=C(CNC(c(cc1)cc2c1OCO2)=O)N/N=C\c(cccc1)c1OCc(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C24H19Cl2N3O5/c25-18-7-5-17(19(26)10-18)13-32-20-4-2-1-3-16(20)11-28-29-23(30)12-27-24(31)15-6-8-21-22(9-15)34-14-33-21/h1-11H,12-14H2,(H,27,31)(H,29,30) |
| InChIK | JOQIYEJUOHUPBZ-UHFFFAOYSA-N |
| TotalMolweight | 500.337 |
| Molweight | 500.337 |
| MonoisotopicMass | 499.070176 |
| CLogP | 4.9568 |
| CLogS | -7.012 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 364.58 |
| Relative PSA | 0.24826 |
| PolarSurfaceArea | 98.25 |
| Druglikeness | 5.0267 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61765 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide | 2 - N-[2-[(2Z)-2-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide