| MolName | 2-[(Z)-[[2-(4-benzylpiperazin-1-ium-1-yl)acetyl]hydrazinylidene]methyl]-4,6-dibromophenolate |
| MolecularFormula | C20H22N4O2Br2 |
| Smiles | [O-]c(c(/C=N\NC(C[NH+]1CCN(Cc2ccccc2)CC1)=O)cc(Br)c1)c1Br |
| InChI | InChI=1S/C20H22Br2N4O2/c21-17-10-16(20(28)18(22)11-17)12-23-24-19(27)14-26-8-6-25(7-9-26)13-15-4-2-1-3-5-15/h1-5,10-12,28H,6-9,13-14H2,(H,24,27) |
| InChIK | JPEVWNIDCQJWEN-UHFFFAOYSA-N |
| TotalMolweight | 510.229 |
| Molweight | 510.229 |
| MonoisotopicMass | 508.010948 |
| CLogP | -0.0352 |
| CLogS | -3.938 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 335.48 |
| Relative PSA | 0.21292 |
| PolarSurfaceArea | 72.2 |
| Druglikeness | 4.0408 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Amines | 2 |
| AlkylAmines | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[[2-(4-benzylpiperazin-1-ium-1-yl)acetyl]hydrazinylidene]methyl]-4,6-dibromophenolate | 2 - 2-[(Z)-[[2-(4-benzylpiperazin-1-ium-1-yl)acetyl]hydrazinylidene]methyl]-4,6-dibromophenolate