| MolName | (Z)-N-[3-[(2,4-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazol-7-yl]-1-thiophen-2-ylmethanimine |
| MolecularFormula | C15H10N6Cl2S2 |
| Smiles | Clc1cc(Cl)c(CSc2nnc3n2ncn3/N=C\c2cccs2)cc1 |
| InChI | InChI=1S/C15H10Cl2N6S2/c16-11-4-3-10(13(17)6-11)8-25-15-21-20-14-22(9-19-23(14)15)18-7-12-2-1-5-24-12/h1-7,9H,8H2 |
| InChIK | JPOLWOXLYZRDLQ-UHFFFAOYSA-N |
| TotalMolweight | 409.324 |
| Molweight | 409.324 |
| MonoisotopicMass | 407.978538 |
| CLogP | 3.6733 |
| CLogS | -6.71 |
| H Acceptors | 6 |
| TotalSurfaceArea | 286.3 |
| Relative PSA | 0.33912 |
| PolarSurfaceArea | 113.91 |
| Druglikeness | 5.8765 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[3-[(2,4-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazol-7-yl]-1-thiophen-2-ylmethanimine | 2 - (Z)-N-[3-[(2,4-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazol-7-yl]-1-thiophen-2-ylmethanimine